Difference between revisions of "Tiso gene 16906"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19202 CPD-19202] == * smiles: ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(N...")
(Created page with "Category:Gene == Gene Tiso_gene_16906 == * right end position: ** 4049 * transcription direction: ** NEGATIVE * left end position: ** 288 * centisome position: ** 7.111111...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19202 CPD-19202] ==
+
== Gene Tiso_gene_16906 ==
−
* smiles:
+
* right end position:
−
** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(NC(CO)C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2))=O)C3(C=CC(O)=CC=3)
+
** 4049
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZHBGOAMEFNAJGS-JUCVYKANSA-O
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** L-4-hydroxyphenylglycine-L-arginyl-D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine
+
** 288
−
* molecular weight:
+
* centisome position:
−
** 709.734    
+
** 7.111111    
 
* Synonym(s):
 
* Synonym(s):
−
** L-pHPG-L-Arg-D-pHPG-L-Ser-L-pHPG
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17832]]
+
* Reaction: [[3.4.11.2-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13677]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-6642]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY66-375]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(NC(CO)C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2))=O)C3(C=CC(O)=CC=3)}}
+
{{#set: right end position=4049}}
−
{{#set: inchi key=InChIKey=ZHBGOAMEFNAJGS-JUCVYKANSA-O}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=L-4-hydroxyphenylglycine-L-arginyl-D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine}}
+
{{#set: left end position=288}}
−
{{#set: molecular weight=709.734   }}
+
{{#set: centisome position=7.111111   }}
−
{{#set: common name=L-pHPG-L-Arg-D-pHPG-L-Ser-L-pHPG}}
+
{{#set: reaction associated=3.4.11.2-RXN|LEUKOTRIENE-A4-HYDROLASE-RXN|RXN-13677|RXN-6642}}
−
{{#set: consumed by=RXN-17832}}
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY66-375}}

Latest revision as of 20:59, 21 March 2018

Gene Tiso_gene_16906

  • right end position:
    • 4049
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 288
  • centisome position:
    • 7.111111
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16906&oldid=45098"