Difference between revisions of "CPD-7003"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine13 tRNA-uridine13] == * common name: ** a uridine13 in tRNA * Synonym(s): ** a tRNA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C | ||
* common name: | * common name: | ||
− | ** | + | ** tetrahydrogeranylgeranyl diphosphate |
+ | * inchi key: | ||
+ | ** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K | ||
+ | * molecular weight: | ||
+ | ** 451.456 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** tetrahydroGGPP |
+ | ** tetrahydrogeranylgeranyl pyrophosphate | ||
+ | ** tetrahydrogeranylgeranyl-PP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-7659]] | ||
+ | * [[RXN-7660]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275] |
− | {{#set: | + | {{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}} |
+ | {{#set: common name=tetrahydrogeranylgeranyl diphosphate}} | ||
+ | {{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}} | ||
+ | {{#set: molecular weight=451.456 }} | ||
+ | {{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}} | ||
+ | {{#set: reversible reaction associated=RXN-7659|RXN-7660}} |
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-7003
- smiles:
- CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
- common name:
- tetrahydrogeranylgeranyl diphosphate
- inchi key:
- InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
- molecular weight:
- 451.456
- Synonym(s):
- tetrahydroGGPP
- tetrahydrogeranylgeranyl pyrophosphate
- tetrahydrogeranylgeranyl-PP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.