Difference between revisions of "Tiso gene 6521"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-7-DIMETHYLXANTHINE 1-7-DIMETHYLXANTHINE] == * smiles: ** CN2(C=NC1(=C(C(N(C(N1)=O)C)=O)2)) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_6521 == * right end position: ** 11897 * transcription direction: ** POSITIVE * left end position: ** 10978 * centisome position: ** 90.674...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6521 == |
− | * | + | * right end position: |
− | ** | + | ** 11897 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 10978 |
− | * | + | * centisome position: |
− | ** | + | ** 90.67482 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-1081]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=11897}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=10978}} | |
− | + | {{#set: centisome position=90.67482 }} | |
− | + | {{#set: reaction associated=RXN0-1081}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:59, 21 March 2018
Gene Tiso_gene_6521
- right end position:
- 11897
- transcription direction:
- POSITIVE
- left end position:
- 10978
- centisome position:
- 90.67482
- Synonym(s):
Reactions associated
- Reaction: RXN0-1081
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation