Difference between revisions of "Tiso gene 15088"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Gene == Gene Tiso_gene_15088 == * Synonym(s): == Reactions associated == * Reaction: L-IDITOL-2-DEHYDROGENASE-RXN ** Source: orthology-esiliculosus * Rea...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
+
== Gene Tiso_gene_15088 ==
−
* smiles:
+
−
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
+
−
* common name:
+
−
** 3-oxo-(5Z)-dodecenoyl-CoA
+
−
* molecular weight:
+
−
** 957.775   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-12:1-Δ5-CoA
 
−
** 3-oxo-5-cis-dodecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17799]]
+
* Reaction: [[L-IDITOL-2-DEHYDROGENASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
* [[RXN-17798]]
+
* Reaction: [[RXN-1102]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-1125]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-7644]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-361]]
 +
* [[PWY-4101]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=L-IDITOL-2-DEHYDROGENASE-RXN|RXN-1102|RXN-1125|RXN-7644}}
−
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}}
+
{{#set: pathway associated=PWY-361|PWY-4101}}
−
{{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}}
+
−
{{#set: molecular weight=957.775    }}
+
−
{{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-17799}}
+
−
{{#set: produced by=RXN-17798}}
+

Latest revision as of 21:00, 21 March 2018

Gene Tiso_gene_15088

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15088&oldid=45168"