Difference between revisions of "Tiso gene 11362"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15977 CPD-15977] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(CCCCCCCC=CCCCCCCCC)=O * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_11362 == * right end position: ** 7749 * transcription direction: ** POSITIVE * left end position: ** 4329 * centisome position: ** 55.1464...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11362 == |
− | * | + | * right end position: |
− | ** | + | ** 7749 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 4329 |
− | * | + | * centisome position: |
− | ** | + | ** 55.146496 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ACETOLACTSYN-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-experimental_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[ACETOOHBUTSYN-RXN]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-12583]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Reaction: [[RXN-14037]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | == Pathways associated == | ||
+ | * [[ILEUSYN-PWY]] | ||
+ | * [[PWY-5938]] | ||
+ | * [[PWY-5939]] | ||
+ | * [[VALSYN-PWY]] | ||
+ | * [[PWY-7111]] | ||
+ | * [[PWY-5103]] | ||
+ | * [[PWY-5101]] | ||
+ | * [[PWY-6389]] | ||
+ | * [[PWY-5104]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7749}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=4329}} | |
− | + | {{#set: centisome position=55.146496 }} | |
− | + | {{#set: reaction associated=ACETOLACTSYN-RXN|ACETOOHBUTSYN-RXN|RXN-12583|RXN-14037}} | |
− | + | {{#set: pathway associated=ILEUSYN-PWY|PWY-5938|PWY-5939|VALSYN-PWY|PWY-7111|PWY-5103|PWY-5101|PWY-6389|PWY-5104}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:18, 21 March 2018
Gene Tiso_gene_11362
- right end position:
- 7749
- transcription direction:
- POSITIVE
- left end position:
- 4329
- centisome position:
- 55.146496
- Synonym(s):
Reactions associated
- Reaction: ACETOLACTSYN-RXN
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: ACETOOHBUTSYN-RXN
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-12583
- Source: orthology-athaliana
- Reaction: RXN-14037
- Source: orthology-athaliana