Difference between revisions of "DIHYDRONEOPTERIN-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-Methylcytosine-DNA 5-Methylcytosine-DNA] == * common name: ** a 5-methylcytosine in DNA * Syn...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P DIHYDRONEOPTERIN-P] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P DIHYDRONEOPTERIN-P] == |
| + | * smiles: | ||
| + | ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2)) | ||
* common name: | * common name: | ||
| − | ** | + | ** 7,8-dihydroneopterin 3'-phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L | ||
| + | * molecular weight: | ||
| + | ** 333.197 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dihydroneopterin 3'-monophosphate |
| − | ** | + | ** dihydroneopterin-P |
| + | ** 2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate | ||
| + | ** dihydroneopterin 3'-phosphate | ||
| + | ** 7,8-dihydro-D-neopterin 3'-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05925 C05925] |
| − | {{#set: | + | * HMDB : HMDB06824 |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58762 58762] | ||
| + | * BIGG : dhpmp | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245170 25245170] | ||
| + | {{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))}} | ||
| + | {{#set: common name=7,8-dihydroneopterin 3'-phosphate}} | ||
| + | {{#set: inchi key=InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L}} | ||
| + | {{#set: molecular weight=333.197 }} | ||
| + | {{#set: common name=dihydroneopterin 3'-monophosphate|dihydroneopterin-P|2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate|dihydroneopterin 3'-phosphate|7,8-dihydro-D-neopterin 3'-phosphate}} | ||
| + | {{#set: consumed by=DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN}} | ||
| + | {{#set: produced by=H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN}} | ||
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite DIHYDRONEOPTERIN-P
- smiles:
- C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))
- common name:
- 7,8-dihydroneopterin 3'-phosphate
- inchi key:
- InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L
- molecular weight:
- 333.197
- Synonym(s):
- dihydroneopterin 3'-monophosphate
- dihydroneopterin-P
- 2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate
- dihydroneopterin 3'-phosphate
- 7,8-dihydro-D-neopterin 3'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))" cannot be used as a page name in this wiki.
