Difference between revisions of "Tiso gene 1110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-804 CPD-804] == * smiles: ** C(CCC(O)CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HNOA...") |
(Created page with "Category:Gene == Gene Tiso_gene_1110 == * right end position: ** 16506 * transcription direction: ** POSITIVE * left end position: ** 15440 * centisome position: ** 59.437...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1110 == |
− | * | + | * right end position: |
− | ** | + | ** 16506 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 15440 |
− | * | + | * centisome position: |
− | ** | + | ** 59.43719 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ADENYLYLSULFKIN-RXN]] |
− | + | ** Source: [[orthology-synechocystis]] | |
− | == | + | * Reaction: [[INORGPYROPHOSPHAT-RXN]] |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7805]] | ||
+ | * [[PWY-7807]] | ||
+ | * [[PWY-5340]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=16506}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=15440}} | |
− | + | {{#set: centisome position=59.43719 }} | |
− | + | {{#set: reaction associated=ADENYLYLSULFKIN-RXN|INORGPYROPHOSPHAT-RXN}} | |
− | + | {{#set: pathway associated=PWY-7805|PWY-7807|PWY-5340}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:00, 21 March 2018
Gene Tiso_gene_1110
- right end position:
- 16506
- transcription direction:
- POSITIVE
- left end position:
- 15440
- centisome position:
- 59.43719
- Synonym(s):
Reactions associated
- Reaction: ADENYLYLSULFKIN-RXN
- Source: orthology-synechocystis
- Reaction: INORGPYROPHOSPHAT-RXN
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: annotation-experimental_annotation