Difference between revisions of "DGTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8585 == * left end position: ** 6090 * transcription direction: ** POSITIVE * right end position: ** 7539 * centisome position: ** 60.38072...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_8585 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] ==
* left end position:
+
* smiles:
** 6090
+
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
* transcription direction:
+
* common name:
** POSITIVE
+
** dGTP
* right end position:
+
* inchi key:
** 7539
+
** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
* centisome position:
+
* molecular weight:
** 60.380726    
+
** 503.152    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2'-deoxyguanosine-5'-triphosphate
 +
** deoxy-GTP
 +
** deoxyguanosine-triphosphate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[6PGLUCONOLACT-RXN]]
+
* [[DGTCY]]
** in-silico_annotation
+
* [[DGTUP]]
***automated-name-match
+
* [[RXN0-385]]
== Pathways associated ==
+
* [[RME255]]
* [[P122-PWY]]
+
* [[RXN-11410]]
* [[RUMP-PWY]]
+
* [[RXN-14208]]
* [[OXIDATIVEPENT-PWY]]
+
* [[RXN-14217]]
* [[GLYCOLYSIS-E-D]]
+
* [[DGTD]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[ATDGD]]
 +
* [[DGDPKIN-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
* [[RXN-14207]]
 
== External links  ==
 
== External links  ==
{{#set: left end position=6090}}
+
* CAS : 2564-35-4
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
{{#set: right end position=7539}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112]
{{#set: centisome position=60.380726   }}
+
* HMDB : HMDB01440
{{#set: reaction associated=6PGLUCONOLACT-RXN}}
+
* LIGAND-CPD:
{{#set: pathway associated=P122-PWY|RUMP-PWY|OXIDATIVEPENT-PWY|GLYCOLYSIS-E-D}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429]
 +
* BIGG : dgtp
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
 +
{{#set: common name=dGTP}}
 +
{{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}}
 +
{{#set: molecular weight=503.152   }}
 +
{{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}}
 +
{{#set: consumed by=DGTCY|DGTUP|RXN0-385|RME255|RXN-11410|RXN-14208|RXN-14217|DGTD}}
 +
{{#set: produced by=ATDGD|DGDPKIN-RXN}}
 +
{{#set: reversible reaction associated=RXN-14207}}

Latest revision as of 20:00, 21 March 2018

Metabolite DGTP

  • smiles:
    • C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
  • common name:
    • dGTP
  • inchi key:
    • InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
  • molecular weight:
    • 503.152
  • Synonym(s):
    • 2'-deoxyguanosine-5'-triphosphate
    • deoxy-GTP
    • deoxyguanosine-triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 2564-35-4
  • PUBCHEM:
  • HMDB : HMDB01440
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : dgtp
"C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.