Difference between revisions of "CPD-15382"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8434 == * Synonym(s): == Reactions associated == * PEPTIDYLPROLYL-ISOMERASE-RXN ** in-silico_annotation ***ec-number == Pathways assoc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * common name: ** keto-D-fructose...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == |
+ | * smiles: | ||
+ | ** C(O)C(=O)C(O)C(O)C(O)CO | ||
+ | * common name: | ||
+ | ** keto-D-fructose | ||
+ | * inchi key: | ||
+ | ** InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N | ||
+ | * molecular weight: | ||
+ | ** 180.157 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14515]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RXN-7644]] |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5984 5984] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48095 48095] | ||
+ | * METABOLIGHTS : MTBLC48095 | ||
+ | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} | ||
+ | {{#set: common name=keto-D-fructose}} | ||
+ | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N}} | ||
+ | {{#set: molecular weight=180.157 }} | ||
+ | {{#set: consumed by=RXN-14515}} | ||
+ | {{#set: reversible reaction associated=RXN-7644}} |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite CPD-15382
- smiles:
- C(O)C(=O)C(O)C(O)C(O)CO
- common name:
- keto-D-fructose
- inchi key:
- InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links