Difference between revisions of "CPD-17049"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6869 == * Synonym(s): == Reactions associated == * 2.4.1.213-RXN ** pantograph-synechocystis * TREHALOSE6PSYN-RXN ** in-si...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * smiles: ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) * common name...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == |
+ | * smiles: | ||
+ | ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) | ||
+ | * common name: | ||
+ | ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine | ||
+ | * inchi key: | ||
+ | ** InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N | ||
+ | * molecular weight: | ||
+ | ** 298.374 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP | ||
+ | ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione | ||
+ | ** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine | ||
+ | ** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP | ||
+ | ** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-15684]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658023 90658023] |
+ | {{#set: smiles=C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)}} | ||
+ | {{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}} | ||
+ | {{#set: inchi key=InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N}} | ||
+ | {{#set: molecular weight=298.374 }} | ||
+ | {{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione}} | ||
+ | {{#set: consumed by=RXN-15684}} |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite CPD-17049
- smiles:
- C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)
- common name:
- 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
- inchi key:
- InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N
- molecular weight:
- 298.374
- Synonym(s):
- 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione
- 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine
- 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: