Difference between revisions of "Tiso gene 18559"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...") |
(Created page with "Category:Gene == Gene Tiso_gene_18559 == * right end position: ** 2300 * transcription direction: ** POSITIVE * left end position: ** 587 * centisome position: ** 14.08687...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_18559 == |
| − | * | + | * right end position: |
| − | ** | + | ** 2300 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 587 |
| − | * | + | * centisome position: |
| − | ** | + | ** 14.086872 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[RXN-8281]] | |
| − | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
| − | == | + | *** Assignment: automated-name-match |
| + | == Pathways associated == | ||
| + | * [[PWY-5338]] | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=2300}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: left end position=587}} |
| − | {{#set: | + | {{#set: centisome position=14.086872 }} |
| − | {{#set: | + | {{#set: reaction associated=RXN-8281}} |
| − | {{#set: | + | {{#set: pathway associated=PWY-5338}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 21:00, 21 March 2018
Gene Tiso_gene_18559
- right end position:
- 2300
- transcription direction:
- POSITIVE
- left end position:
- 587
- centisome position:
- 14.086872
- Synonym(s):
Reactions associated
- Reaction: RXN-8281
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
