Difference between revisions of "CPD-17312"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NITRIC-OXIDE NITRIC-OXIDE] == * smiles: ** N=O * inchi key: ** InChIKey=MWUXSHHQAYIFBG-UHFFFAOY...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17312 CPD-17312] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17312 CPD-17312] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** docosahexaenoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=MENFZXMQSYYVRK-CRCGJGBYSA-J | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1073.981 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA |
− | ** | + | ** (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA |
− | ** | + | ** (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl-CoA |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-16137]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-16063]] | ||
+ | * [[RXN-16103]] | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581248 71581248] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74298 74298] |
− | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | {{#set: smiles=N=O}} | + | {{#set: common name=docosahexaenoyl-CoA}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=MENFZXMQSYYVRK-CRCGJGBYSA-J}} |
− | {{#set: | + | {{#set: molecular weight=1073.981 }} |
− | {{#set: molecular weight= | + | {{#set: common name=all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl-CoA}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-16137}} |
− | {{#set: | + | {{#set: reversible reaction associated=RXN-16063|RXN-16103}} |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite CPD-17312
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- docosahexaenoyl-CoA
- inchi key:
- InChIKey=MENFZXMQSYYVRK-CRCGJGBYSA-J
- molecular weight:
- 1073.981
- Synonym(s):
- all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA
- (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA
- (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.