Difference between revisions of "RXN-7647"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == * smiles: ** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7647 RXN-7647] == * direction: ** LEFT-TO-RIGHT * common name: ** atp-dependent_rna_helicase_dh...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7647 RXN-7647] ==
−
* smiles:
+
* direction:
−
** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M
+
 
* common name:
 
* common name:
−
** mycophenolic acid O-acyl-glucuronide
+
** atp-dependent_rna_helicase_dhx30-like
−
* molecular weight:
+
* ec number:
−
** 495.459   
+
** [http://enzyme.expasy.org/EC/5.5.1.6 EC-5.5.1.6]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-13607]]
+
** 1 [[CPD-6993]][c] '''=>''' 1 [[CPD-6991]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 pinocembrin chalcone[c] '''=>''' 1 (2S)-pinocembrin[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9838]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_13414]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5059]], pinobanksin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5059 PWY-5059]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678773 70678773]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07990 R07990]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66982 66982]
+
{{#set: common name=atp-dependent_rna_helicase_dhx30-like}}
−
{{#set: smiles=CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)}}
+
{{#set: ec number=EC-5.5.1.6}}
−
{{#set: inchi key=InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M}}
+
{{#set: gene associated=Tiso_gene_9838|Tiso_gene_13414}}
−
{{#set: common name=mycophenolic acid O-acyl-glucuronide}}
+
{{#set: in pathway=PWY-5059}}
−
{{#set: molecular weight=495.459    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: produced by=RXN-13607}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:01, 21 March 2018

Reaction RXN-7647

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • atp-dependent_rna_helicase_dhx30-like
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 pinocembrin chalcone[c] => 1 (2S)-pinocembrin[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5059, pinobanksin biosynthesis: PWY-5059
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7647&oldid=45244"