Difference between revisions of "CPD-18238"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R95 R95] == * direction: ** LEFT-TO-RIGHT * common name: ** R95 * Synonym(s): == Reaction Formula...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] == * smiles: ** C(=O)([O-])OP([O-])(=O)O * common name: ** carboxyphosphat...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)([O-])OP([O-])(=O)O |
* common name: | * common name: | ||
| − | ** | + | ** carboxyphosphate |
| + | * inchi key: | ||
| + | ** InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L | ||
| + | * molecular weight: | ||
| + | ** 139.989 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-16910]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-16909]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826591 91826591] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | + | ** [http://www.chemspider.com/Chemical-Structure.169776.html 169776] | |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86994 86994] |
| − | {{#set: | + | {{#set: smiles=C(=O)([O-])OP([O-])(=O)O}} |
| + | {{#set: common name=carboxyphosphate}} | ||
| + | {{#set: inchi key=InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L}} | ||
| + | {{#set: molecular weight=139.989 }} | ||
| + | {{#set: consumed by=RXN-16910}} | ||
| + | {{#set: produced by=RXN-16909}} | ||
Latest revision as of 20:01, 21 March 2018
Contents
Metabolite CPD-18238
- smiles:
- C(=O)([O-])OP([O-])(=O)O
- common name:
- carboxyphosphate
- inchi key:
- InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L
- molecular weight:
- 139.989
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])OP([O-])(=O)O" cannot be used as a page name in this wiki.
