Difference between revisions of "CPD-15666"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18302 RXN-18302] == * direction: ** LEFT-TO-RIGHT * common name: ** digalactosyldiacylglycerol_...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18302 RXN-18302] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
** digalactosyldiacylglycerol_synthase
+
** 6-cis, 2-trans-tridecadienoyl-CoA
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/2.4.1.241 EC-2.4.1.241]
+
** InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
 +
* molecular weight:
 +
** 955.803   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6Z, 2E-tridecadienoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CPD-14553]][c] '''+''' 1 [[A-GALACTOSYLCERAMIDE]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Digalactosylceramides]][c]
+
* [[RXN-14771]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 UDP-α-D-galactose[c] '''+''' 1 a β-D-galactosyl-N-acylsphingosine[c] '''=>''' 1 UDP[c] '''+''' 1 H+[c] '''+''' 1 a digalactosylceramide[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_2142]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
* [[Tiso_gene_106]]
+
** IN-SILICO_ANNOTATION
+
***AUTOMATED-NAME-MATCH
+
* [[Tiso_gene_11479]]
+
** EXPERIMENTAL_ANNOTATION
+
***EC-NUMBER
+
== Pathways  ==
+
* [[PWY-7840]], gala-series glycosphingolipids biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7840 PWY-7840]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[experimental_annotation]]
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=digalactosyldiacylglycerol_synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658546 90658546]
{{#set: ec number=EC-2.4.1.241}}
+
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: gene associated=Tiso_gene_2142|Tiso_gene_106|Tiso_gene_11479}}
+
{{#set: common name=6-cis, 2-trans-tridecadienoyl-CoA}}
{{#set: in pathway=PWY-7840}}
+
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J}}
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=955.803    }}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=6Z, 2E-tridecadienoyl-CoA}}
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: produced by=RXN-14771}}

Latest revision as of 20:02, 21 March 2018

Metabolite CPD-15666

  • smiles:
    • CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 6-cis, 2-trans-tridecadienoyl-CoA
  • inchi key:
    • InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
  • molecular weight:
    • 955.803
  • Synonym(s):
    • 6Z, 2E-tridecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.