Difference between revisions of "Tiso gene 5838"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] == * smiles: ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_5838 == * right end position: ** 3410 * transcription direction: ** POSITIVE * left end position: ** 1939 * centisome position: ** 15.06136...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5838 == |
− | * | + | * right end position: |
− | ** | + | ** 3410 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1939 |
− | * | + | * centisome position: |
− | ** | + | ** 15.061363 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[MERCAPYSTRANS-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | ** Source: [[annotation-experimental_annotation]] |
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN0-6359]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN0-6385]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[THIOSULFATE-SULFURTRANSFERASE-RXN]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5329]] | ||
+ | * [[PWY-5350]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3410}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1939}} | |
− | + | {{#set: centisome position=15.061363 }} | |
− | + | {{#set: reaction associated=MERCAPYSTRANS-RXN|RXN0-6359|RXN0-6385|THIOSULFATE-SULFURTRANSFERASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5329|PWY-5350}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:02, 21 March 2018
Gene Tiso_gene_5838
- right end position:
- 3410
- transcription direction:
- POSITIVE
- left end position:
- 1939
- centisome position:
- 15.061363
- Synonym(s):
Reactions associated
- Reaction: MERCAPYSTRANS-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN0-6359
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: RXN0-6385
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Reaction: THIOSULFATE-SULFURTRANSFERASE-RXN
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation