Difference between revisions of "CPD-14378"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-NrdH-Proteins Reduced-NrdH-Proteins] == * common name: ** a reduced NrdH glutaredoxin-l...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] == * smiles: ** C([N+])CC[N+]=CCCC[N+] * common name: ** dehydrospermidine...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-NrdH-Proteins Reduced-NrdH-Proteins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] ==
 +
* smiles:
 +
** C([N+])CC[N+]=CCCC[N+]
 
* common name:
 
* common name:
** a reduced NrdH glutaredoxin-like protein
+
** dehydrospermidine
 +
* inchi key:
 +
** InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q
 +
* molecular weight:
 +
** 146.255   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-722]]
+
* [[RXN-13415]]
* [[RXN0-748]]
+
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
+
* [[RXN0-747]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13414]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a reduced NrdH glutaredoxin-like protein}}
+
* PUBCHEM:
{{#set: consumed by=RXN0-722|RXN0-748|RIBONUCLEOSIDE-DIP-REDUCTII-RXN|RXN0-747}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266746 45266746]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58732 58732]
 +
* METABOLIGHTS : MTBLC58732
 +
{{#set: smiles=C([N+])CC[N+]=CCCC[N+]}}
 +
{{#set: common name=dehydrospermidine}}
 +
{{#set: inchi key=InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q}}
 +
{{#set: molecular weight=146.255    }}
 +
{{#set: consumed by=RXN-13415}}
 +
{{#set: produced by=RXN-13414}}

Latest revision as of 21:02, 21 March 2018

Metabolite CPD-14378

  • smiles:
    • C([N+])CC[N+]=CCCC[N+]
  • common name:
    • dehydrospermidine
  • inchi key:
    • InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q
  • molecular weight:
    • 146.255
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([N+])CC[N+]=CCCC[N+" cannot be used as a page name in this wiki.