Difference between revisions of "RXN-12200"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] == * smiles: ** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12200 RXN-12200] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12200 RXN-12200] ==
−
* smiles:
+
* direction:
−
** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J
+
 
* common name:
 
* common name:
−
** N5-methyl--tetrahydropteroyl tri-L-glutamate
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 713.66   
+
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
 
* Synonym(s):
 
* Synonym(s):
−
** N5-methyl--H4PteGlu3
 
−
** 5-methyltetrahydropteroyl tri-L-glutamate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[CTP]][c] '''+''' 2 [[WATER]][c] '''=>''' 1 [[CMP]][c] '''+''' 2 [[Pi]][c] '''+''' 2 [[PROTON]][c]
−
* [[HOMOCYSMET-RXN]]
+
* With common name(s):
 +
** 1 CTP[c] '''+''' 2 H2O[c] '''=>''' 1 CMP[c] '''+''' 2 phosphate[c] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_20236]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7185]], UTP and CTP dephosphorylation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7185 PWY-7185]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-7177]], UTP and CTP dephosphorylation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7177 PWY-7177]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852302 49852302]
+
{{#set: common name=ORF}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-3.6.1.5}}
−
** [http://www.chemspider.com/Chemical-Structure.17625689.html 17625689]
+
{{#set: gene associated=Tiso_gene_20236|Tiso_gene_12899}}
−
* CHEBI:
+
{{#set: in pathway=PWY-7185|PWY-7177}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58207 58207]
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation|orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04489 C04489]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
* HMDB : HMDB12177
+
−
{{#set: smiles=CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))}}
+
−
{{#set: inchi key=InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J}}
+
−
{{#set: common name=N5-methyl--tetrahydropteroyl tri-L-glutamate}}
+
−
{{#set: molecular weight=713.66    }}
+
−
{{#set: common name=N5-methyl--H4PteGlu3|5-methyltetrahydropteroyl tri-L-glutamate}}
+
−
{{#set: consumed or produced by=HOMOCYSMET-RXN}}
+

Latest revision as of 20:02, 21 March 2018

Reaction RXN-12200

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 CTP[c] + 2 H2O[c] => 1 CMP[c] + 2 phosphate[c] + 2 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7185, UTP and CTP dephosphorylation I: PWY-7185
    • 5 reactions found over 5 reactions in the full pathway
  • PWY-7177, UTP and CTP dephosphorylation II: PWY-7177
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12200&oldid=45456"