Difference between revisions of "Tiso gene 9986"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * inchi key: *...")
(Created page with "Category:Gene == Gene Tiso_gene_9986 == * Synonym(s): == Reactions associated == * Reaction: UBIQUITIN-THIOLESTERASE-RXN ** Source: orthology-esiliculosus == Path...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] ==
+
== Gene Tiso_gene_9986 ==
* smiles:
+
** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
+
* inchi key:
+
** InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
+
* common name:
+
** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
+
* molecular weight:
+
** 264.169   
+
 
* Synonym(s):
 
* Synonym(s):
** cThz-P
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12610]]
+
* Reaction: [[UBIQUITIN-THIOLESTERASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=UBIQUITIN-THIOLESTERASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477624 53477624]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62890 62890]
+
{{#set: smiles=CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)}}
+
{{#set: inchi key=InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K}}
+
{{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}}
+
{{#set: molecular weight=264.169    }}
+
{{#set: common name=cThz-P}}
+
{{#set: consumed by=RXN-12610}}
+

Latest revision as of 20:02, 21 March 2018

Gene Tiso_gene_9986

  • Synonym(s):

Reactions associated

Pathways associated

External links