Difference between revisions of "H2Otx"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(=C(O2)C=C(O)C(O)=C(O)3))) * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=H2Otx H2Otx] == * direction: ** REVERSIBLE * common name: ** H2O transport, peroxisomal * Synonym(s...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=H2Otx H2Otx] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** H2O transport, peroxisomal |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1.0 [[WATER]][c] '''<=>''' 1.0 [[WATER]][x] |
− | == | + | * With common name(s): |
+ | ** 1.0 H2O[c] '''<=>''' 1.0 H2O[x] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_11818]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=H2O transport, peroxisomal}} | |
− | + | {{#set: gene associated=Tiso_gene_11818}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:03, 21 March 2018
Contents
Reaction H2Otx
- direction:
- REVERSIBLE
- common name:
- H2O transport, peroxisomal
- Synonym(s):
Reaction Formula
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11818
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii