Difference between revisions of "CPD-15377"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_286 == * left end position: ** 30517 * transcription direction: ** POSITIVE * right end position: ** 32742 * centisome position: ** 83.6196...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15377 CPD-15377] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * common name: ** aldehydo-D-xylose...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15377 CPD-15377] == |
| − | * | + | * smiles: |
| − | ** | + | ** [CH](=O)C(O)C(O)C(O)CO |
| − | * | + | * common name: |
| − | ** | + | ** aldehydo-D-xylose |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PYMYPHUHKUWMLA-VPENINKCSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 150.131 |
* Synonym(s): | * Synonym(s): | ||
| + | ** linear D-xylose | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14503]] | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644160 644160] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15936 15936] |
| − | {{#set: reaction associated= | + | * METABOLIGHTS : MTBLC15936 |
| + | * HMDB : HMDB60254 | ||
| + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}} | ||
| + | {{#set: common name=aldehydo-D-xylose}} | ||
| + | {{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VPENINKCSA-N}} | ||
| + | {{#set: molecular weight=150.131 }} | ||
| + | {{#set: common name=linear D-xylose}} | ||
| + | {{#set: reversible reaction associated=RXN-14503}} | ||
Latest revision as of 20:03, 21 March 2018
Contents
Metabolite CPD-15377
- smiles:
- [CH](=O)C(O)C(O)C(O)CO
- common name:
- aldehydo-D-xylose
- inchi key:
- InChIKey=PYMYPHUHKUWMLA-VPENINKCSA-N
- molecular weight:
- 150.131
- Synonym(s):
- linear D-xylose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.
