Difference between revisions of "CPD-356"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D13-25-3-hydroxyC44-2-ACPs cis-cis-D13-25-3-hydroxyC44-2-ACPs] == * common name: ** a c...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-356 CPD-356] == * smiles: ** C(O)C1(OC(=O)C(O)C(O)1) * common name: ** D-arabinono-1,4-lact...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D13-25-3-hydroxyC44-2-ACPs cis-cis-D13-25-3-hydroxyC44-2-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-356 CPD-356] ==
 +
* smiles:
 +
** C(O)C1(OC(=O)C(O)C(O)1)
 
* common name:
 
* common name:
** a cis,cis-delta13,25-3-hydroxyC44:2-[acp]
+
** D-arabinono-1,4-lactone
 +
* inchi key:
 +
** InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N
 +
* molecular weight:
 +
** 148.115   
 
* Synonym(s):
 
* Synonym(s):
** a cis,cis 13,25-3-hydroxy C44:2-[acyl-carrier-protein]
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.1.3.37-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-203]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a cis,cis-delta13,25-3-hydroxyC44:2-[acp]}}
+
* PUBCHEM:
{{#set: common name=a cis,cis 13,25-3-hydroxy C44:2-[acyl-carrier-protein]}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=17723 17723]
{{#set: produced by=RXN1G-203}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.16751.html 16751]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16292 16292]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00652 C00652]
 +
{{#set: smiles=C(O)C1(OC(=O)C(O)C(O)1)}}
 +
{{#set: common name=D-arabinono-1,4-lactone}}
 +
{{#set: inchi key=InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N}}
 +
{{#set: molecular weight=148.115    }}
 +
{{#set: consumed by=1.1.3.37-RXN}}

Latest revision as of 20:03, 21 March 2018

Metabolite CPD-356

  • smiles:
    • C(O)C1(OC(=O)C(O)C(O)1)
  • common name:
    • D-arabinono-1,4-lactone
  • inchi key:
    • InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N
  • molecular weight:
    • 148.115
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links