Difference between revisions of "RXN-17352"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYLTHIOADENOSINE 5-METHYLTHIOADENOSINE] == * smiles: ** CSCC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17352 RXN-17352] == * direction: ** LEFT-TO-RIGHT * common name: ** ascorbate_peroxidase ** ORF...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYLTHIOADENOSINE 5-METHYLTHIOADENOSINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17352 RXN-17352] ==
−
* smiles:
+
* direction:
−
** CSCC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WUUGFSXJNOTRMR-IOSLPCCCSA-N
+
 
* common name:
 
* common name:
−
** S-methyl-5'-thioadenosine
+
** ascorbate_peroxidase
−
* molecular weight:
+
** ORF
−
** 297.331   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.11.1.7 EC-1.11.1.7]
 
* Synonym(s):
 
* Synonym(s):
−
** methylthioadenosine
 
−
** 5'-methylthioadenosine
 
−
** S-methyl-5'-thioadenosine
 
−
** MTA
 
−
** S-methyl-adenosine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[M5TAP]]
+
* With identifiers:
−
* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
+
** 2 [[CONIFERYL-ALCOHOL]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''=>''' 2 [[WATER]][c] '''+''' 2 [[CPD-18761]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[APAPT]]
+
** 2 coniferyl alcohol[c] '''+''' 1 hydrogen peroxide[c] '''=>''' 2 H2O[c] '''+''' 2 coniferyl alcohol radical[c]
−
* [[RXN0-5217]]
+
 
−
* [[SPERMINE-SYNTHASE-RXN]]
+
== Genes associated with this reaction  ==
−
* [[4.4.1.14-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN-12347]]
+
* Gene: [[Tiso_gene_11016]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[SPERMIDINESYN-RXN]]
+
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_15820]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_15962]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6824]], justicidin B biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6824 PWY-6824]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-5466]], matairesinol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5466 PWY-5466]
 +
** '''1''' reactions found over '''10''' reactions in the full pathway
 +
* [[PWY-5469]], sesamin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5469 PWY-5469]
 +
** '''1''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2457-80-9
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC17509
+
{{#set: common name=ascorbate_peroxidase}}
−
* DRUGBANK : DB02282
+
{{#set: common name=ORF}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.11.1.7}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439176 439176]
+
{{#set: gene associated=Tiso_gene_11016|Tiso_gene_15820|Tiso_gene_15962}}
−
* HMDB : HMDB01173
+
{{#set: in pathway=PWY-6824|PWY-5466|PWY-5469}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00170 C00170]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.chemspider.com/Chemical-Structure.388321.html 388321]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17509 17509]
+
−
* BIGG : 5mta
+
−
{{#set: smiles=CSCC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23)))}}
+
−
{{#set: inchi key=InChIKey=WUUGFSXJNOTRMR-IOSLPCCCSA-N}}
+
−
{{#set: common name=S-methyl-5'-thioadenosine}}
+
−
{{#set: molecular weight=297.331    }}
+
−
{{#set: common name=methylthioadenosine|5'-methylthioadenosine|S-methyl-5'-thioadenosine|MTA|S-methyl-adenosine}}
+
−
{{#set: consumed by=M5TAP|METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN}}
+
−
{{#set: produced by=APAPT|RXN0-5217|SPERMINE-SYNTHASE-RXN|4.4.1.14-RXN|RXN-12347}}
+
−
{{#set: consumed or produced by=SPERMIDINESYN-RXN}}
+

Latest revision as of 20:03, 21 March 2018

Reaction RXN-17352

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ascorbate_peroxidase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6824, justicidin B biosynthesis: PWY-6824
    • 1 reactions found over 6 reactions in the full pathway
  • PWY-5466, matairesinol biosynthesis: PWY-5466
    • 1 reactions found over 10 reactions in the full pathway
  • PWY-5469, sesamin biosynthesis: PWY-5469
    • 1 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17352&oldid=45572"