Difference between revisions of "PWY-6535"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] == * smiles: ** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1) * inchi key: ** InChIKe...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6535 PWY-6535] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6535 PWY-6535] ==
−
* smiles:
+
* taxonomic range:
−
** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
** InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** 3-acetylamino-4-hydroxybenzaldehyde
+
** 4-aminobutanoate degradation I
−
* molecular weight:
+
−
** 178.167   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** γ-amino-butyrate shunt
 +
** GABA degradation
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[GABATRANSAM-RXN]]
−
* [[RXN-13871]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_11231]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
* [[SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_777]]
 +
*** [[Tiso_gene_91]]
 +
*** [[Tiso_gene_6952]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657664 90657664]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6535 PWY-6535]
−
{{#set: smiles=CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)}}
+
{{#set: taxonomic range=TAX-33154}}
−
{{#set: inchi key=InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M}}
+
{{#set: taxonomic range=TAX-33090}}
−
{{#set: common name=3-acetylamino-4-hydroxybenzaldehyde}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: molecular weight=178.167    }}
+
{{#set: common name=4-aminobutanoate degradation I}}
−
{{#set: consumed or produced by=RXN-13871}}
+
{{#set: common name=γ-amino-butyrate shunt|GABA degradation}}
 +
{{#set: reaction found=2}}
 +
{{#set: total reaction=2}}
 +
{{#set: completion rate=100.0}}

Latest revision as of 19:19, 21 March 2018

Pathway PWY-6535

  • taxonomic range:
  • common name:
    • 4-aminobutanoate degradation I
  • Synonym(s):
    • γ-amino-butyrate shunt
    • GABA degradation

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6535&oldid=40841"