Difference between revisions of "CPD-15663"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_17143 == * left end position: ** 21 * transcription direction: ** POSITIVE * right end position: ** 3149 * centisome position: ** 0.5399846...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15663 CPD-15663] == * smiles: ** CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15663 CPD-15663] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * common name: |
| − | ** | + | ** 2-trans-nonenoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HBLOTZDYPZAZLE-OWQWVSLFSA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 901.711 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2E-nonenoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-14793]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193739 72193739] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76292 76292] |
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: common name=2-trans-nonenoyl-CoA}} |
| + | {{#set: inchi key=InChIKey=HBLOTZDYPZAZLE-OWQWVSLFSA-J}} | ||
| + | {{#set: molecular weight=901.711 }} | ||
| + | {{#set: common name=2E-nonenoyl-CoA}} | ||
| + | {{#set: produced by=RXN-14793}} | ||
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite CPD-15663
- smiles:
- CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 2-trans-nonenoyl-CoA
- inchi key:
- InChIKey=HBLOTZDYPZAZLE-OWQWVSLFSA-J
- molecular weight:
- 901.711
- Synonym(s):
- 2E-nonenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
