Difference between revisions of "CPD-9446"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == * smiles: ** C(O)C1(OCC(O)C(O)C(O)1) * common name: ** 1,5-anhydro-D-mann...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** C(O)C1(OCC(O)C(O)C(O)1) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 1,5-anhydro-D-mannitol |
| + | * inchi key: | ||
| + | ** InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 164.158 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1,5-anhydromannitol |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13064]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445184 445184] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.392897.html 392897] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49182 49182] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16538 C16538] |
| − | {{#set: smiles=C | + | {{#set: smiles=C(O)C1(OCC(O)C(O)C(O)1)}} |
| − | {{#set: | + | {{#set: common name=1,5-anhydro-D-mannitol}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=164.158 }} |
| − | {{#set: common name= | + | {{#set: common name=1,5-anhydromannitol}} |
| − | {{#set: consumed | + | {{#set: consumed by=RXN-13064}} |
| − | + | ||
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite CPD-9446
- smiles:
- C(O)C1(OCC(O)C(O)C(O)1)
- common name:
- 1,5-anhydro-D-mannitol
- inchi key:
- InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N
- molecular weight:
- 164.158
- Synonym(s):
- 1,5-anhydromannitol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
