Difference between revisions of "FORMYLTHFGLUSYNTH-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O * inchi key:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FORMYLTHFGLUSYNTH-RXN FORMYLTHFGLUSYNTH-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** bif...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FORMYLTHFGLUSYNTH-RXN FORMYLTHFGLUSYNTH-RXN] ==
−
* smiles:
+
* direction:
−
** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N
+
 
* common name:
 
* common name:
−
** melibiose
+
** bifunctional_protein
−
* molecular weight:
+
** folylpolyglutamate_synthase
−
** 342.299   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.3.2.17 EC-6.3.2.17]
 
* Synonym(s):
 
* Synonym(s):
−
** 6-O-(α-D-galactopyranosyl)-D-glucopyranose
 
−
** D-Gal-α(1->6)-D-glucose
 
−
** D-melibiose
 
−
** 6-O-α-D-galactopyranosyl-D-glucose
 
−
** 6-(α-D-galactosido)-D-glucose
 
−
** α-D-Galp-(1->6)-D-Glc
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[ALPHAGALACTOSID-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[GLT]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[FORMYL-THF-GLU-N]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[FORMYL-THF-GLU-N]][c] '''+''' 1 [[Pi]][c]
−
* [[RFH]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 L-glutamate[c] '''+''' 1 ATP[c] '''+''' 1 an N10-formyl-tetrahydrofolate[c] '''=>''' 1 ADP[c] '''+''' 1 an N10-formyl-tetrahydrofolate[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15942]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_92]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-2161]], folate polyglutamylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2161 PWY-2161]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 585-99-9
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=bifunctional_protein}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11458 11458]
+
{{#set: common name=folylpolyglutamate_synthase}}
−
* HMDB : HMDB00048
+
{{#set: ec number=EC-6.3.2.17}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_15942|Tiso_gene_92}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05402 C05402]
+
{{#set: in pathway=PWY-2161}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.10974.html 10974]
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61827 61827]
+
−
* BIGG : melib
+
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O}}
+
−
{{#set: inchi key=InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N}}
+
−
{{#set: common name=melibiose}}
+
−
{{#set: molecular weight=342.299    }}
+
−
{{#set: common name=6-O-(α-D-galactopyranosyl)-D-glucopyranose|D-Gal-α(1->6)-D-glucose|D-melibiose|6-O-α-D-galactopyranosyl-D-glucose|6-(α-D-galactosido)-D-glucose|α-D-Galp-(1->6)-D-Glc}}
+
−
{{#set: consumed by=ALPHAGALACTOSID-RXN}}
+
−
{{#set: produced by=RFH}}
+

Latest revision as of 20:04, 21 March 2018

Reaction FORMYLTHFGLUSYNTH-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • bifunctional_protein
    • folylpolyglutamate_synthase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-glutamate[c] + 1 ATP[c] + 1 an N10-formyl-tetrahydrofolate[c] => 1 ADP[c] + 1 an N10-formyl-tetrahydrofolate[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2161, folate polyglutamylation: PWY-2161
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=FORMYLTHFGLUSYNTH-RXN&oldid=45680"