Difference between revisions of "Oxidized-2Fe-2S-Ferredoxins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * smiles: ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) * inchi key: ** InC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-2Fe-2S-Ferredoxins Oxidized-2Fe-2S-Ferredoxins] == * common name: ** an oxidized [2Fe-...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-2Fe-2S-Ferredoxins Oxidized-2Fe-2S-Ferredoxins] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an oxidized [2Fe-2S] ferredoxin |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14950]] |
+ | * [[RXN-14957]] | ||
+ | * [[RXN-14959]] | ||
+ | * [[RXN-17472]] | ||
+ | * [[RXN0-949]] | ||
+ | * [[2.8.1.6-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=an oxidized [2Fe-2S] ferredoxin}} | |
− | + | {{#set: produced by=RXN-14950|RXN-14957|RXN-14959|RXN-17472|RXN0-949|2.8.1.6-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite Oxidized-2Fe-2S-Ferredoxins
- common name:
- an oxidized [2Fe-2S] ferredoxin
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an oxidized [2Fe-2S] ferredoxin" cannot be used as a page name in this wiki.