Difference between revisions of "R01752"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == * smiles: ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01752 R01752] == * direction: ** REVERSIBLE * common name: ** R260 * Synonym(s): == Reaction Form...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01752 R01752] ==
* smiles:
+
* direction:
** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
+
** REVERSIBLE
* inchi key:
+
** InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
+
 
* common name:
 
* common name:
** 5-hydroxy-CTP
+
** R260
* molecular weight:
+
** 495.126   
+
 
* Synonym(s):
 
* Synonym(s):
** 5-hydroxycytidine triphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN0-7080]]
+
** 1.0 [[NAD]][c] '''+''' 1.0 [[WATER]][c] '''+''' 1.0 [[GLYCERALD]][c] '''<=>''' 1.0 [[GLYCERATE]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 NAD+[c] '''+''' 1.0 H2O[c] '''+''' 1.0 D-glyceraldehyde[c] '''<=>''' 1.0 D-glycerate[c] '''+''' 1.0 H+[c] '''+''' 1.0 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7322]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202584 25202584]
+
{{#set: common name=R260}}
{{#set: smiles=C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}}
+
{{#set: gene associated=Tiso_gene_7322}}
{{#set: inchi key=InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=5-hydroxy-CTP}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=495.126    }}
+
{{#set: reconstruction source=orthology-synechocystis}}
{{#set: common name=5-hydroxycytidine triphosphate}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: produced by=RXN0-7080}}
+

Latest revision as of 21:05, 21 March 2018

Reaction R01752

  • direction:
    • REVERSIBLE
  • common name:
    • R260
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NAD+[c] + 1.0 H2O[c] + 1.0 D-glyceraldehyde[c] <=> 1.0 D-glycerate[c] + 1.0 H+[c] + 1.0 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links