Difference between revisions of "2-OCTAPRENYL-6-METHOXYPHENOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ASN-tRNAs Charged-ASN-tRNAs] == * common name: ** an L-asparaginyl-[tRNAasn] * Synonym(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-METHOXYPHENOL 2-OCTAPRENYL-6-METHOXYPHENOL] == * smiles: ** CC(=CCCC(=CCCC(=CCCC...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-METHOXYPHENOL 2-OCTAPRENYL-6-METHOXYPHENOL] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C | ||
* common name: | * common name: | ||
− | ** | + | ** 2-methoxy-6-(all-trans-octaprenyl)phenol |
+ | * inchi key: | ||
+ | ** InChIKey=MARGKPIMNMASKJ-CMAXTTDKSA-N | ||
+ | * molecular weight: | ||
+ | ** 669.085 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-methoxy-6-all-trans-octaprenylphenol | ||
+ | ** 2-octaprenyl-6-methoxyphenol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280834 5280834] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.4444383.html 4444383] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1235 1235] | ||
+ | * BIGG : 2omph | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05812 C05812] | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C}} | ||
+ | {{#set: common name=2-methoxy-6-(all-trans-octaprenyl)phenol}} | ||
+ | {{#set: inchi key=InChIKey=MARGKPIMNMASKJ-CMAXTTDKSA-N}} | ||
+ | {{#set: molecular weight=669.085 }} | ||
+ | {{#set: common name=2-methoxy-6-all-trans-octaprenylphenol|2-octaprenyl-6-methoxyphenol}} | ||
+ | {{#set: produced by=2-OCTAPRENYL-6-OHPHENOL-METHY-RXN}} |
Latest revision as of 20:05, 21 March 2018
Contents
Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C
- common name:
- 2-methoxy-6-(all-trans-octaprenyl)phenol
- inchi key:
- InChIKey=MARGKPIMNMASKJ-CMAXTTDKSA-N
- molecular weight:
- 669.085
- Synonym(s):
- 2-methoxy-6-all-trans-octaprenylphenol
- 2-octaprenyl-6-methoxyphenol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links