Difference between revisions of "Tiso gene 7372"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=LHFJO...")
(Created page with "Category:Gene == Gene Tiso_gene_7372 == * right end position: ** 9349 * transcription direction: ** POSITIVE * left end position: ** 6584 * centisome position: ** 58.48805...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] ==
+
== Gene Tiso_gene_7372 ==
−
* smiles:
+
* right end position:
−
** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
+
** 9349
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** monodehydroascorbate radical
+
** 6584
−
* molecular weight:
+
* centisome position:
−
** 175.118    
+
** 58.488052    
 
* Synonym(s):
 
* Synonym(s):
−
** monodehydroascorbic acid
 
−
** semidehydroascorbic acid
 
−
** semidehydroascorbate
 
−
** ascorbyl radical
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-3523]]
+
* Reaction: [[DAHPSYN-RXN]]
−
* [[1.6.5.4-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
−
* [[RXN-10981]]
+
== Pathways associated ==
−
* [[RXN-3521]]
+
* [[PWY-6164]]
−
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=9349}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5483640 5483640]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=6584}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16504 16504]
+
{{#set: centisome position=58.488052   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=DAHPSYN-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01041 C01041]
+
{{#set: pathway associated=PWY-6164}}
−
{{#set: smiles=C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)}}
+
−
{{#set: inchi key=InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N}}
+
−
{{#set: common name=monodehydroascorbate radical}}
+
−
{{#set: molecular weight=175.118   }}
+
−
{{#set: common name=monodehydroascorbic acid|semidehydroascorbic acid|semidehydroascorbate|ascorbyl radical}}
+
−
{{#set: consumed by=RXN-3523|1.6.5.4-RXN}}
+
−
{{#set: produced by=RXN-10981|RXN-3521}}
+

Latest revision as of 20:05, 21 March 2018

Gene Tiso_gene_7372

  • right end position:
    • 9349
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6584
  • centisome position:
    • 58.488052
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7372&oldid=45793"