Difference between revisions of "CPD-12303"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10297 == * left end position: ** 8774 * transcription direction: ** NEGATIVE * right end position: ** 11148 * centisome position: ** 74.570...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12303 CPD-12303] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12303 CPD-12303] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C |
− | * | + | * common name: |
− | ** | + | ** undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K |
− | * | + | * molecular weight: |
− | ** | + | ** 1598.955 |
* Synonym(s): | * Synonym(s): | ||
+ | ** mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol | ||
+ | ** lipid I (tetrapeptide) | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-11347]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657616 90657616] |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C}} |
− | {{#set: | + | {{#set: common name=undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K}} |
− | {{#set: | + | {{#set: molecular weight=1598.955 }} |
+ | {{#set: common name=mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol|lipid I (tetrapeptide)}} | ||
+ | {{#set: produced by=RXN-11347}} |
Latest revision as of 21:05, 21 March 2018
Contents
Metabolite CPD-12303
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C
- common name:
- undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine
- inchi key:
- InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K
- molecular weight:
- 1598.955
- Synonym(s):
- mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol
- lipid I (tetrapeptide)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.