Difference between revisions of "RXN-17852"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17852 RXN-17852] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17852 RXN-17852] ==
* smiles:
+
* direction:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
* common name:
+
* ec number:
** 3,8-divinyl chlorophyllide a
+
** [http://enzyme.expasy.org/EC/2.3.1.bt EC-2.3.1.bt]
* molecular weight:
+
** 610.951   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-5286]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[ACETYL-COA]][c] '''+''' 1 [[L-methionyl-L-aspartyl-Protein]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[N-Ac-L-methionyl-L-aspartyl-Protein]][c]
* [[RXN-5285]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 acetyl-CoA[c] '''+''' 1 an N-terminal-L-methionyl-L-aspartyl-[protein][c] '''=>''' 1 coenzyme A[c] '''+''' 1 H+[c] '''+''' 1 an N-terminal-Nα-acetyl-L-methionyl-L-aspartyl-[protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7800]], Ac/N-end rule pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7800 PWY-7800]
 +
** '''21''' reactions found over '''21''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927710 56927710]
+
{{#set: ec number=EC-2.3.1.bt}}
* CHEMSPIDER:
+
{{#set: in pathway=PWY-7800}}
** [http://www.chemspider.com/Chemical-Structure.391650.html 391650]
+
{{#set: reconstruction category=annotation}}
* CHEBI:
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38259 38259]
+
{{#set: reconstruction tool=pathwaytools}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11832 C11832]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=3,8-divinyl chlorophyllide a}}
+
{{#set: molecular weight=610.951    }}
+
{{#set: consumed by=RXN-5286}}
+
{{#set: produced by=RXN-5285}}
+

Latest revision as of 20:05, 21 March 2018

Reaction RXN-17852

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7800, Ac/N-end rule pathway: PWY-7800
    • 21 reactions found over 21 reactions in the full pathway

Reconstruction information

External links