Difference between revisions of "RXN-9673"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] == * smiles: ** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9673 RXN-9673] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** long_c...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9673 RXN-9673] ==
−
* smiles:
+
* direction:
−
** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L
+
 
* common name:
 
* common name:
−
** FADH2
+
** polyketide_synthase
−
* molecular weight:
+
** long_chain_acyl-_synthetase
−
** 785.556   
+
** acyl-_synthetase
 +
** ORF
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** flavin adenine dinucleotide reduced
 
−
** 1,5-dihydro-FAD
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[G3PD3]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CO-A]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[LINOLEIC_ACID]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[CPD-18]][c]
−
* [[MEPROPCOA-FAD-RXN]]
+
* With common name(s):
−
* [[ACOA120or]]
+
** 1 coenzyme A[c] '''+''' 1 ATP[c] '''+''' 1 linoleate[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 linoleoyl-CoA[c]
−
* [[MCDH_2mb2coa]]
+
 
−
* [[ACOA140or]]
+
== Genes associated with this reaction  ==
−
* [[ACOA160or]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[ACOA80or]]
+
* Gene: [[Tiso_gene_136]]
−
* [[MCDH]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[IVCDH]]
+
*** Assignment: EC-NUMBER
−
* [[ACOA40or]]
+
* Gene: [[Tiso_gene_348]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[PPCOAOm]]
+
*** Assignment: EC-NUMBER
−
* [[RXN-14264]]
+
** Source: [[annotation-experimental_annotation]]
−
* [[RXN-14193]]
+
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4191]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6000]], γ-linolenate biosynthesis II (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6000 PWY-6000]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1910-41-4
+
* RHEA:
−
* METABOLIGHTS : MTBLC58307
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33652 33652]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931118 46931118]
+
{{#set: common name=polyketide_synthase}}
−
* HMDB : HMDB01197
+
{{#set: common name=long_chain_acyl-_synthetase}}
−
* LIGAND-CPD:
+
{{#set: common name=acyl-_synthetase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01352 C01352]
+
{{#set: common name=ORF}}
−
* CHEBI:
+
{{#set: ec number=EC-6.2.1.3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58307 58307]
+
{{#set: gene associated=Tiso_gene_136|Tiso_gene_348|Tiso_gene_13394|Tiso_gene_4191|Tiso_gene_7855|Tiso_gene_500|Tiso_gene_9394|Tiso_gene_135|Tiso_gene_10876}}
−
* BIGG : fadh2
+
{{#set: in pathway=PWY-6000}}
−
{{#set: smiles=CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: inchi key=InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: common name=FADH2}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: molecular weight=785.556    }}
+
−
{{#set: common name=flavin adenine dinucleotide reduced|1,5-dihydro-FAD}}
+
−
{{#set: consumed by=G3PD3}}
+
−
{{#set: produced by=MEPROPCOA-FAD-RXN|ACOA120or|MCDH_2mb2coa|ACOA140or|ACOA160or|ACOA80or|MCDH|IVCDH|ACOA40or}}
+
−
{{#set: consumed or produced by=PPCOAOm|RXN-14264|RXN-14193}}
+

Latest revision as of 20:05, 21 March 2018

Reaction RXN-9673

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • polyketide_synthase
    • long_chain_acyl-_synthetase
    • acyl-_synthetase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 coenzyme A[c] + 1 ATP[c] + 1 linoleate[c] => 1 AMP[c] + 1 diphosphate[c] + 1 linoleoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6000, γ-linolenate biosynthesis II (animals): PWY-6000
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9673&oldid=45882"