Difference between revisions of "CPD-548"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10345 == * left end position: ** 5754 * transcription direction: ** POSITIVE * right end position: ** 8151 * centisome position: ** 66.7904...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-] * common na...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == |
− | * | + | * smiles: |
− | ** | + | ** C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** S-formylglutathione |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FHXAGOICBFGEBF-BQBZGAKWSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 334.323 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-2962]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN0-276]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : Sfglutth |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246250 25246250] |
− | {{#set: | + | * HMDB : HMDB01550 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01031 C01031] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16225 16225] | ||
+ | * METABOLIGHTS : MTBLC57688 | ||
+ | {{#set: smiles=C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-]}} | ||
+ | {{#set: common name=S-formylglutathione}} | ||
+ | {{#set: inchi key=InChIKey=FHXAGOICBFGEBF-BQBZGAKWSA-M}} | ||
+ | {{#set: molecular weight=334.323 }} | ||
+ | {{#set: consumed by=S-FORMYLGLUTATHIONE-HYDROLASE-RXN}} | ||
+ | {{#set: produced by=RXN-2962}} | ||
+ | {{#set: reversible reaction associated=RXN0-276}} |
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite CPD-548
- smiles:
- C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-]
- common name:
- S-formylglutathione
- inchi key:
- InChIKey=FHXAGOICBFGEBF-BQBZGAKWSA-M
- molecular weight:
- 334.323
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : Sfglutth
- PUBCHEM:
- HMDB : HMDB01550
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57688
"C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.