Difference between revisions of "Tiso gene 10345"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi k...") |
(Created page with "Category:Gene == Gene Tiso_gene_10345 == * right end position: ** 8151 * transcription direction: ** POSITIVE * left end position: ** 5754 * centisome position: ** 66.7904...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10345 == |
− | * | + | * right end position: |
− | ** | + | ** 8151 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 5754 |
− | * | + | * centisome position: |
− | ** | + | ** 66.79048 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.8.1.6-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | ** Source: [[annotation-experimental_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Reaction: [[RXN-17472]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | == | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[RXN-17473]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY0-1507]] | ||
+ | * [[PWY-7380]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=8151}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=5754}} | |
− | + | {{#set: centisome position=66.79048 }} | |
− | + | {{#set: reaction associated=2.8.1.6-RXN|RXN-17472|RXN-17473}} | |
− | + | {{#set: pathway associated=PWY0-1507|PWY-7380}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 19:19, 21 March 2018
Gene Tiso_gene_10345
- right end position:
- 8151
- transcription direction:
- POSITIVE
- left end position:
- 5754
- centisome position:
- 66.79048
- Synonym(s):
Reactions associated
- Reaction: 2.8.1.6-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-17472
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-17473
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation