Difference between revisions of "Ferrihemoglobins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] == * smiles: ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ferrihemoglobins Ferrihemoglobins] == * common name: ** a ferrihemoglobin * Synonym(s): ** a me...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ferrihemoglobins Ferrihemoglobins] ==
* smiles:
+
** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J
+
 
* common name:
 
* common name:
** 2-trans, 4-cis-undecadienoyl-CoA
+
** a ferrihemoglobin
* molecular weight:
+
** 927.749   
+
 
* Synonym(s):
 
* Synonym(s):
** 2E, 4Z-undecadienoyl-CoA
+
** a methemoglobin
 +
** metHb
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11195]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14775]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a ferrihemoglobin}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658228 90658228]
+
{{#set: common name=a methemoglobin|metHb}}
{{#set: smiles=CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: consumed by=RXN-11195}}
{{#set: inchi key=InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J}}
+
{{#set: common name=2-trans, 4-cis-undecadienoyl-CoA}}
+
{{#set: molecular weight=927.749    }}
+
{{#set: common name=2E, 4Z-undecadienoyl-CoA}}
+
{{#set: produced by=RXN-14775}}
+

Latest revision as of 20:06, 21 March 2018

Metabolite Ferrihemoglobins

  • common name:
    • a ferrihemoglobin
  • Synonym(s):
    • a methemoglobin
    • metHb

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links