Difference between revisions of "RXN-13181"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13181 RXN-13181] == * direction: ** LEFT-TO-RIGHT * common name: ** sialate_o-acetylesterase-li...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13181 RXN-13181] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** D-hexose 6-phosphate
+
** sialate_o-acetylesterase-like_protein
−
* molecular weight:
+
** ORF
−
** 258.121   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.1.53 EC-3.1.1.53]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-414]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ACET]][c] '''+''' 1 [[N-ACETYLNEURAMINATE]][c]
−
* [[HEXOKINASE-RXN]]
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 N-acetyl-4-O-acetylneuraminate[c] '''=>''' 1 H+[c] '''+''' 1 acetate[c] '''+''' 1 N-acetylneuraminate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17029]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4419]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4418]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4459709 4459709]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25567 25567]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.3658466.html 3658466]
+
{{#set: common name=sialate_o-acetylesterase-like_protein}}
−
* CHEBI:
+
{{#set: common name=ORF}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61567 61567]
+
{{#set: ec number=EC-3.1.1.53}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_17029|Tiso_gene_4419|Tiso_gene_4418}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02965 C02965]
+
{{#set: in pathway=}}
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: common name=D-hexose 6-phosphate}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: consumed or produced by=HEXOKINASE-RXN}}
+

Latest revision as of 20:06, 21 March 2018

Reaction RXN-13181

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • sialate_o-acetylesterase-like_protein
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 N-acetyl-4-O-acetylneuraminate[c] => 1 H+[c] + 1 acetate[c] + 1 N-acetylneuraminate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13181&oldid=45963"