Difference between revisions of "G3PD3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] == * smiles: ** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G3PD3 G3PD3] == * direction: ** LEFT-TO-RIGHT * common name: ** glycerol-3-phosphate dehydrogenase...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=G3PD3 G3PD3] ==
−
* smiles:
+
* direction:
−
** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J
+
 
* common name:
 
* common name:
−
** vinylacetyl-CoA
+
** glycerol-3-phosphate dehydrogenase (FAD)
−
* molecular weight:
+
−
** 831.577   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-butenoyl-CoA
 
−
** but-3-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''+''' 1.0 [[FADH2]][c] '''=>''' 1.0 [[FAD]][c] '''+''' 1.0 [[GLYCEROL-3P]][c]
−
* [[VINYLACETYL-COA-DELTA-ISOMERASE-RXN]]
+
* With common name(s):
 +
** 1.0 glycerone phosphate[c] '''+''' 1.0 FADH2[c] '''=>''' 1.0 FAD[c] '''+''' 1.0 sn-glycerol 3-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15777]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266616 45266616]
+
{{#set: common name=glycerol-3-phosphate dehydrogenase (FAD)}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_15777}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57396 57396]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02331 C02331]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J}}
+
−
{{#set: common name=vinylacetyl-CoA}}
+
−
{{#set: molecular weight=831.577    }}
+
−
{{#set: common name=3-butenoyl-CoA|but-3-enoyl-CoA}}
+
−
{{#set: consumed or produced by=VINYLACETYL-COA-DELTA-ISOMERASE-RXN}}
+

Latest revision as of 20:06, 21 March 2018

Reaction G3PD3

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • glycerol-3-phosphate dehydrogenase (FAD)
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=G3PD3&oldid=45969"