Difference between revisions of "RXN66-13"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == * smiles:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-13 RXN66-13] == * direction: ** LEFT-TO-RIGHT * common name: ** 4,4-dimethyl-14α-formyl...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-13 RXN66-13] ==
−
* smiles:
+
* direction:
−
** CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J
+
 
* common name:
 
* common name:
−
** 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
+
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol deformylase
−
* molecular weight:
+
−
** 597.259   
+
 
* Synonym(s):
 
* Synonym(s):
−
** CDP-ME-2P
 
−
** CDP-methyl-D-erylthritol 2-phosphate
 
−
** 4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate
 
−
** 4-diphosphocytidyl-2-C-methylerythritol 2-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-302]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-8608]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-8609]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[FORMATE]][c]
−
* [[2.7.1.148-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''=>''' 1 H2O[c] '''+''' 1 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol[c] '''+''' 1 NADP+[c] '''+''' 1 formate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_8263]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3]
 +
** '''8''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878430 46878430]
+
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol deformylase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_8263}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57919 57919]
+
{{#set: in pathway=PWY66-3}}
−
* BIGG : 2p4c2me
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11436 C11436]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O}}
+
−
{{#set: inchi key=InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J}}
+
−
{{#set: common name=2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol}}
+
−
{{#set: molecular weight=597.259    }}
+
−
{{#set: common name=CDP-ME-2P|CDP-methyl-D-erylthritol 2-phosphate|4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate|4-diphosphocytidyl-2-C-methylerythritol 2-phosphate}}
+
−
{{#set: consumed by=RXN0-302}}
+
−
{{#set: produced by=2.7.1.148-RXN}}
+

Latest revision as of 20:06, 21 March 2018

Reaction RXN66-13

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol deformylase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol[c] + 1 oxygen[c] + 1 NADPH[c] => 1 H2O[c] + 1 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol[c] + 1 NADP+[c] + 1 formate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-3, cholesterol biosynthesis II (via 24,25-dihydrolanosterol): PWY66-3
    • 8 reactions found over 22 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-13&oldid=45981"