Difference between revisions of "RXN-18082"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] == * smiles: ** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18082 RXN-18082] == * direction: ** LEFT-TO-RIGHT * common name: ** beta-hexosaminidase * ec nu...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18082 RXN-18082] ==
* smiles:
+
* direction:
** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M
+
 
* common name:
 
* common name:
** canavaninosuccinate
+
** beta-hexosaminidase
* molecular weight:
+
* ec number:
** 291.24   
+
** [http://enzyme.expasy.org/EC/3.2.1.52 EC-3.2.1.52]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-22]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CHITIN]][c] '''=>''' 1 [[CHITIN]][c] '''+''' 1 [[N-acetyl-D-glucosamine]][c]
* [[RXN-10]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 chitin[c] '''=>''' 1 chitin[c] '''+''' 1 N-acetyl-D-glucosamine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1129]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14122]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820246 91820246]
+
{{#set: common name=beta-hexosaminidase}}
* HMDB : HMDB12197
+
{{#set: ec number=EC-3.2.1.52}}
{{#set: smiles=C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O}}
+
{{#set: gene associated=Tiso_gene_1129|Tiso_gene_14122}}
{{#set: inchi key=InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M}}
+
{{#set: in pathway=}}
{{#set: common name=canavaninosuccinate}}
+
{{#set: reconstruction category=annotation}}
{{#set: molecular weight=291.24    }}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: consumed by=RXN-22}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: produced by=RXN-10}}
+

Latest revision as of 20:06, 21 March 2018

Reaction RXN-18082

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • beta-hexosaminidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links