Difference between revisions of "LIPOIC-ACID"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7776 == * left end position: ** 4073 * transcription direction: ** NEGATIVE * right end position: ** 7026 * centisome position: ** 37.65717...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOIC-ACID LIPOIC-ACID] == * smiles: ** C(CCC(=O)[O-])CC1(CCSS1) * common name: ** (R)-lipoate...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOIC-ACID LIPOIC-ACID] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(CCC(=O)[O-])CC1(CCSS1) |
| − | * | + | * common name: |
| − | ** | + | ** (R)-lipoate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=AGBQKNBQESQNJD-SSDOTTSWSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 205.309 |
* Synonym(s): | * Synonym(s): | ||
| + | ** α-liponic acid | ||
| + | ** 5-(1,2-dithiolan-3-yl)-pentanoate | ||
| + | ** lipoic acid | ||
| + | ** 6,8-thioctic acid | ||
| + | ** 6,8-thioctate | ||
| + | ** DL-thioctic acid | ||
| + | ** DL-thioctate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-17127]] |
| − | + | * [[RXN0-1141]] | |
| − | + | * [[RXN-8654]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN0- | + | |
| − | * | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 62-46-4 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549144 1549144] |
| − | {{#set: | + | * HMDB : HMDB01451 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16241 C16241] | |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.841.html 841] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83088 83088] | ||
| + | * METABOLIGHTS : MTBLC30313 | ||
| + | {{#set: smiles=C(CCC(=O)[O-])CC1(CCSS1)}} | ||
| + | {{#set: common name=(R)-lipoate}} | ||
| + | {{#set: inchi key=InChIKey=AGBQKNBQESQNJD-SSDOTTSWSA-M}} | ||
| + | {{#set: molecular weight=205.309 }} | ||
| + | {{#set: common name=α-liponic acid|5-(1,2-dithiolan-3-yl)-pentanoate|lipoic acid|6,8-thioctic acid|6,8-thioctate|DL-thioctic acid|DL-thioctate}} | ||
| + | {{#set: consumed by=RXN-17127|RXN0-1141|RXN-8654}} | ||
Latest revision as of 20:06, 21 March 2018
Contents
Metabolite LIPOIC-ACID
- smiles:
- C(CCC(=O)[O-])CC1(CCSS1)
- common name:
- (R)-lipoate
- inchi key:
- InChIKey=AGBQKNBQESQNJD-SSDOTTSWSA-M
- molecular weight:
- 205.309
- Synonym(s):
- α-liponic acid
- 5-(1,2-dithiolan-3-yl)-pentanoate
- lipoic acid
- 6,8-thioctic acid
- 6,8-thioctate
- DL-thioctic acid
- DL-thioctate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 62-46-4
- PUBCHEM:
- HMDB : HMDB01451
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC30313
"C(CCC(=O)[O-])CC1(CCSS1)" cannot be used as a page name in this wiki.
