Difference between revisions of "RXN66-18"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMINE THYMINE] == * smiles: ** CC1(C(=O)NC(NC=1)=O) * inchi key: ** InChIKey=RWQNBRDOKXIBIV-U...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-18 RXN66-18] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMINE THYMINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-18 RXN66-18] ==
* smiles:
+
* direction:
** CC1(C(=O)NC(NC=1)=O)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=RWQNBRDOKXIBIV-UHFFFAOYSA-N
+
** [http://enzyme.expasy.org/EC/1.1.1.170 EC-1.1.1.170]
* common name:
+
** thymine
+
* molecular weight:
+
** 126.115   
+
 
* Synonym(s):
 
* Synonym(s):
** 5-methyluracil
 
** 5-methyl-2,4(1H,3H)-pyrimidinedione
 
** T
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD-8613]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[CPD-8614]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
* [[THYM-PHOSPH-RXN]]
+
* With common name(s):
 +
** 1 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol[c] '''+''' 1 NAD(P)+[c] '''=>''' 1 4α-methyl-5α-cholesta-8-en-3-one[c] '''+''' 1 NAD(P)H[c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_897]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3]
 +
** '''8''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 65-71-4
+
{{#set: direction=LEFT-TO-RIGHT}}
* METABOLIGHTS : MTBLC17821
+
{{#set: ec number=EC-1.1.1.170}}
* DRUGBANK : DB03462
+
{{#set: gene associated=Tiso_gene_897}}
* PUBCHEM:
+
{{#set: in pathway=PWY66-3}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1135 1135]
+
{{#set: reconstruction category=orthology}}
* HMDB : HMDB00262
+
{{#set: reconstruction source=orthology-esiliculosus}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C00178 C00178]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.1103.html 1103]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17821 17821]
+
* BIGG : thym
+
{{#set: smiles=CC1(C(=O)NC(NC=1)=O)}}
+
{{#set: inchi key=InChIKey=RWQNBRDOKXIBIV-UHFFFAOYSA-N}}
+
{{#set: common name=thymine}}
+
{{#set: molecular weight=126.115    }}
+
{{#set: common name=5-methyluracil|5-methyl-2,4(1H,3H)-pyrimidinedione|T}}
+
{{#set: consumed or produced by=THYM-PHOSPH-RXN}}
+

Latest revision as of 20:06, 21 March 2018

Reaction RXN66-18

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-3, cholesterol biosynthesis II (via 24,25-dihydrolanosterol): PWY66-3
    • 8 reactions found over 22 reactions in the full pathway

Reconstruction information

External links