Difference between revisions of "RXN-11521"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == * smiles: ** CC(O)(C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=XFTRTWQBIOMV...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11521 RXN-11521] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11521 RXN-11521] ==
* smiles:
+
* direction:
** CC(O)(C(=O)[O-])CC(=O)[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L
+
* common name:
+
** (R)-citramalate
+
* molecular weight:
+
** 146.099   
+
 
* Synonym(s):
 
* Synonym(s):
** (R)-2-methylmalic acid
 
** (3R)-citramalate
 
** (3R)-citramalic acid
 
** (3R)-α-hydroxypyrotartaric acid
 
** D-citramalate
 
** D-citramalic acid
 
** D-α-hydroxypyrotartaric acid
 
** (R)-2-methylmalate
 
** (R)-(-)-citramalic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-7743]]
+
** 1 [[WATER]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[7-METHYLXANTHINE]][c] '''=>''' 1 [[CPD-12481]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 oxygen[c] '''+''' 1 7-methylxanthine[c] '''=>''' 1 7-methylurate[c] '''+''' 1 hydrogen peroxide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11775]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-6632]], caffeine degradation IV (bacteria, via demethylation and oxidation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6632 PWY-6632]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 6236-10-8
+
* LIGAND-RXN:
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07979 R07979]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460281 5460281]
+
{{#set: direction=LEFT-TO-RIGHT}}
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_11775}}
** [http://www.chemspider.com/Chemical-Structure.4573870.html 4573870]
+
{{#set: in pathway=PWY-6632}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30934 30934]
+
{{#set: reconstruction source=orthology-athaliana}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C02612 C02612]
+
{{#set: smiles=CC(O)(C(=O)[O-])CC(=O)[O-]}}
+
{{#set: inchi key=InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L}}
+
{{#set: common name=(R)-citramalate}}
+
{{#set: molecular weight=146.099    }}
+
{{#set: common name=(R)-2-methylmalic acid|(3R)-citramalate|(3R)-citramalic acid|(3R)-α-hydroxypyrotartaric acid|D-citramalate|D-citramalic acid|D-α-hydroxypyrotartaric acid|(R)-2-methylmalate|(R)-(-)-citramalic acid}}
+
{{#set: produced by=RXN-7743}}
+

Latest revision as of 20:06, 21 March 2018

Reaction RXN-11521

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6632, caffeine degradation IV (bacteria, via demethylation and oxidation): PWY-6632
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links