Difference between revisions of "CPD-4127"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6998 == * Synonym(s): == Reactions associated == * TRANS-RXN-101 ** pantograph-creinhardtii ** pantograph-creinhardtii...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == |
+ | * smiles: | ||
+ | ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
+ | * common name: | ||
+ | ** isofucosterol | ||
+ | * inchi key: | ||
+ | ** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N | ||
+ | * molecular weight: | ||
+ | ** 412.698 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-4210]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281326 5281326] | ||
+ | * HMDB : HMDB02374 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821] | ||
+ | {{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: common name=isofucosterol}} | ||
+ | {{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}} | ||
+ | {{#set: molecular weight=412.698 }} | ||
+ | {{#set: produced by=RXN-4210}} |
Latest revision as of 21:06, 21 March 2018
Contents
Metabolite CPD-4127
- smiles:
- CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- isofucosterol
- inchi key:
- InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
- molecular weight:
- 412.698
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.