Difference between revisions of "MANNITOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5MeAminoMe-2-ThioU tRNA-Containing-5MeAminoMe-2-ThioU] == * common name: ** a 5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL MANNITOL] == * smiles: ** C(C(C(C(C(CO)O)O)O)O)O * common name: ** D-mannitol * inchi...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL MANNITOL] == |
| + | * smiles: | ||
| + | ** C(C(C(C(C(CO)O)O)O)O)O | ||
* common name: | * common name: | ||
| − | ** | + | ** D-mannitol |
| + | * inchi key: | ||
| + | ** InChIKey=FBPFZTCFMRRESA-KVTDHHQDSA-N | ||
| + | * molecular weight: | ||
| + | ** 182.173 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** D-mitobronitol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[MANNITOL-1-PHOSPHATASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[1.1.1.255-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 69-65-8 |
| − | {{#set: common name= | + | * BIGG : mnl |
| − | {{#set: produced by= | + | * DRUGBANK : DB00742 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6251 6251] | ||
| + | * HMDB : HMDB00765 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00392 C00392] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.6015.html 6015] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16899 16899] | ||
| + | * METABOLIGHTS : MTBLC16899 | ||
| + | {{#set: smiles=C(C(C(C(C(CO)O)O)O)O)O}} | ||
| + | {{#set: common name=D-mannitol}} | ||
| + | {{#set: inchi key=InChIKey=FBPFZTCFMRRESA-KVTDHHQDSA-N}} | ||
| + | {{#set: molecular weight=182.173 }} | ||
| + | {{#set: common name=D-mitobronitol}} | ||
| + | {{#set: produced by=MANNITOL-1-PHOSPHATASE-RXN}} | ||
| + | {{#set: reversible reaction associated=1.1.1.255-RXN}} | ||
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite MANNITOL
- smiles:
- C(C(C(C(C(CO)O)O)O)O)O
- common name:
- D-mannitol
- inchi key:
- InChIKey=FBPFZTCFMRRESA-KVTDHHQDSA-N
- molecular weight:
- 182.173
- Synonym(s):
- D-mitobronitol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 69-65-8
- BIGG : mnl
- DRUGBANK : DB00742
- PUBCHEM:
- HMDB : HMDB00765
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16899
