Difference between revisions of "CPD-414"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15103 == * left end position: ** 34 * transcription direction: ** POSITIVE * right end position: ** 4665 * centisome position: ** 0.6497229...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-414 CPD-414] == * smiles: ** CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O * common na...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-414 CPD-414] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O |
| − | * | + | * common name: |
| − | ** | + | ** N-acetyl-4-O-acetylneuraminate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=LVBIMVQYUKOENY-FODKYPIKSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 350.302 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-13181]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244557 25244557] |
| − | {{#set: | + | * HMDB : HMDB00796 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29006 29006] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04015 C04015] | ||
| + | {{#set: smiles=CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O}} | ||
| + | {{#set: common name=N-acetyl-4-O-acetylneuraminate}} | ||
| + | {{#set: inchi key=InChIKey=LVBIMVQYUKOENY-FODKYPIKSA-M}} | ||
| + | {{#set: molecular weight=350.302 }} | ||
| + | {{#set: consumed by=RXN-13181}} | ||
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite CPD-414
- smiles:
- CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O
- common name:
- N-acetyl-4-O-acetylneuraminate
- inchi key:
- InChIKey=LVBIMVQYUKOENY-FODKYPIKSA-M
- molecular weight:
- 350.302
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O" cannot be used as a page name in this wiki.
