Difference between revisions of "CPD-19179"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15745 RXN-15745] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15745 RXN-15745] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.1.5.3 EC-1.1.5.3]
+
** (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
 +
* inchi key:
 +
** InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J
 +
* molecular weight:
 +
** 519.151   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3',8-cH2GTP
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ETR-Quinones]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[ETR-Quinols]][c] '''+''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c]
+
* [[RXN-8340]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an electron-transfer quinone[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 an electron-transfer quinol[c] '''+''' 1 glycerone phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15777]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-4261]], glycerol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4261 PWY-4261]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-6118]], glycerol-3-phosphate shuttle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6118 PWY-6118]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-6952]], glycerophosphodiester degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6952 PWY-6952]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))}}
−
{{#set: ec number=EC-1.1.5.3}}
+
{{#set: common name=(8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}}
−
{{#set: gene associated=Tiso_gene_15777}}
+
{{#set: inchi key=InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J}}
−
{{#set: in pathway=PWY-4261|PWY-6118|PWY-6952}}
+
{{#set: molecular weight=519.151    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=3',8-cH2GTP}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-8340}}
−
{{#set: reconstruction source=esiliculosus}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Latest revision as of 20:07, 21 March 2018

Metabolite CPD-19179

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))
  • common name:
    • (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
  • inchi key:
    • InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J
  • molecular weight:
    • 519.151
  • Synonym(s):
    • 3',8-cH2GTP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-19179&oldid=46081"