Difference between revisions of "CPD-713"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-INDOLYLGLYCOLALDEHYDE 3-INDOLYLGLYCOLALDEHYDE] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)C=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 6-oxocampestanol |
| + | * inchi key: | ||
| + | ** InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 416.686 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** oxocampestanol |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-715]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061347 16061347] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20747 20747] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15789 C15789] |
| − | {{#set: smiles= | + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: | + | {{#set: common name=6-oxocampestanol}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=416.686 }} |
| − | {{#set: common name= | + | {{#set: common name=oxocampestanol}} |
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-715}} |
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite CPD-713
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 6-oxocampestanol
- inchi key:
- InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
- molecular weight:
- 416.686
- Synonym(s):
- oxocampestanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
