Difference between revisions of "Tiso gene 4284"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] == * smiles: ** C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1) * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Tiso_gene_4284 == * right end position: ** 2586 * transcription direction: ** NEGATIVE * left end position: ** 53 * centisome position: ** 0.3513657...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] ==
+
== Gene Tiso_gene_4284 ==
−
* smiles:
+
* right end position:
−
** C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1)
+
** 2586
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YXJDFQJKERBOBM-TXICZTDVSA-L
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** α-D-ribose-1-phosphate
+
** 53
−
* molecular weight:
+
* centisome position:
−
** 228.095    
+
** 0.3513657    
 
* Synonym(s):
 
* Synonym(s):
−
** D-ribose-1-phosphate
 
−
** α-D-ribose-1P
 
−
** α-D-ribofuranose 1-phosphate
 
−
** ribose-1-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-12587]]
−
* [[XANTHOSINEPHOSPHORY-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[URPHOS-RXN]]
+
** Source: [[annotation-experimental_annotation]]
−
* [[INOPHOSPHOR-RXN]]
+
*** Assignment: ec-number
−
* [[RXN-14456]]
+
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-12588]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14382]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14384]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14385]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14386]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-15881]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9787]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN0-308]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY0-1021]]
 +
* [[PWY-6823]]
 +
* [[PWY-7250]]
 +
* [[PWY-6892]]
 +
* [[PWY-6891]]
 
== External links  ==
 
== External links  ==
−
* CAS : 58459-37-3
+
{{#set: right end position=2586}}
−
* CAS : 14075-00-4
+
{{#set: transcription direction=NEGATIVE}}
−
* METABOLIGHTS : MTBLC57720
+
{{#set: left end position=53}}
−
* PUBCHEM:
+
{{#set: centisome position=0.3513657   }}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615443 23615443]
+
{{#set: reaction associated=RXN-12587|RXN-12588|RXN-14382|RXN-14384|RXN-14385|RXN-14386|RXN-15881|RXN-9787|RXN0-308}}
−
* HMDB : HMDB01489
+
{{#set: pathway associated=PWY0-1021|PWY-6823|PWY-7250|PWY-6892|PWY-6891}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00620 C00620]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.19951495.html 19951495]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57720 57720]
+
−
* BIGG : r1p
+
−
{{#set: smiles=C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1)}}
+
−
{{#set: inchi key=InChIKey=YXJDFQJKERBOBM-TXICZTDVSA-L}}
+
−
{{#set: common name=α-D-ribose-1-phosphate}}
+
−
{{#set: molecular weight=228.095   }}
+
−
{{#set: common name=D-ribose-1-phosphate|α-D-ribose-1P|α-D-ribofuranose 1-phosphate|ribose-1-phosphate}}
+
−
{{#set: produced by=XANTHOSINEPHOSPHORY-RXN}}
+
−
{{#set: consumed or produced by=URPHOS-RXN|INOPHOSPHOR-RXN|RXN-14456}}
+

Latest revision as of 20:07, 21 March 2018

Gene Tiso_gene_4284

  • right end position:
    • 2586
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 53
  • centisome position:
    • 0.3513657
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4284&oldid=46104"